ChemNet > CAS > 605-62-9 4-Nitro-1-Naphthol
605-62-9 4-Nitro-1-Naphthol
| Nome del prodotto |
4-Nitro-1-Naphthol |
| Sinonimi |
4-nitronaphthalen-1-ol |
| Formula molecolare |
C10H7NO3 |
| Peso Molecolare |
189.1675 |
| InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
| Numero CAS |
605-62-9 |
| Struttura molecolare |
|
| Densità |
1.413g/cm3 |
| Punto di ebollizione |
398.8°C at 760 mmHg |
| Indice di rifrazione |
1.714 |
| Punto d'infiammabilità |
179.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
