ChemNet > CAS > 6135-31-5 Methyl N-ethylcarbamate
6135-31-5 Methyl N-ethylcarbamate
| Nome del prodotto |
Methyl N-ethylcarbamate |
| Sinonimi |
N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
| Formula molecolare |
C4H9NO2 |
| Peso Molecolare |
103.1198 |
| InChI |
InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
| Numero CAS |
6135-31-5 |
| Struttura molecolare |
|
| Densità |
0.964g/cm3 |
| Punto di ebollizione |
172°C at 760 mmHg |
| Indice di rifrazione |
1.4 |
| Punto d'infiammabilità |
57.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
