ChemNet > CAS > 621-63-6 2,2-diethoxyethanol
621-63-6 2,2-diethoxyethanol
| Nome del prodotto |
2,2-diethoxyethanol |
| Sinonimi |
Hydroxyacetaldehyde diethyl acetal; 2,2-diethoxy ethanol; glycolaldehyde diethyl acetal |
| Formula molecolare |
C6H14O3 |
| Peso Molecolare |
134.1736 |
| InChI |
InChI=1/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3 |
| Numero CAS |
621-63-6 |
| EINECS |
210-697-5 |
| Struttura molecolare |
|
| Densità |
0.97g/cm3 |
| Punto di ebollizione |
167°C at 760 mmHg |
| Indice di rifrazione |
1.418 |
| Punto d'infiammabilità |
68.4°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
