ChemNet > CAS > 625-48-9 2-Nitroethanol
625-48-9 2-Nitroethanol
| Nome del prodotto |
2-Nitroethanol |
| Sinonimi |
1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
| Formula molecolare |
C2H5NO3 |
| Peso Molecolare |
91.07 |
| InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
| Numero CAS |
625-48-9 |
| EINECS |
210-895-1 |
| Struttura molecolare |
|
| Densità |
1.267g/cm3 |
| Punto di ebollizione |
193.8°C at 760 mmHg |
| Indice di rifrazione |
1.438 |
| Punto d'infiammabilità |
113.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
