ChemNet > CAS > 6306-07-6 1-Acenaphthenol
6306-07-6 1-Acenaphthenol
| Nome del prodotto |
1-Acenaphthenol |
| Formula molecolare |
C12H10O |
| Peso Molecolare |
170.2072 |
| InChI |
InChI=1/C12H10O/c13-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11,13H,7H2/t11-/m1/s1 |
| Numero CAS |
6306-07-6 |
| EINECS |
228-618-8 |
| Struttura molecolare |
|
| Densità |
1.29g/cm3 |
| Punto di fusione |
147-148℃ |
| Punto di ebollizione |
369.2°C at 760 mmHg |
| Indice di rifrazione |
1.741 |
| Punto d'infiammabilità |
129°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
