ChemNet > CAS > 632-22-4 1,1,3,3-Tetramethylurea
632-22-4 1,1,3,3-Tetramethylurea
| Nome del prodotto |
1,1,3,3-Tetramethylurea |
| Sinonimi |
Tetramethylurea |
| Formula molecolare |
C5H12N2O |
| Peso Molecolare |
116.16 |
| InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
| Numero CAS |
632-22-4 |
| EINECS |
211-173-9 |
| Struttura molecolare |
|
| Densità |
0.9879 |
| Punto di fusione |
-1℃ |
| Punto di ebollizione |
174-178℃ |
| Indice di rifrazione |
1.4496-1.4516 |
| Punto d'infiammabilità |
65℃ |
| Solubilità in acqua |
miscible |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R22:;
|
| Sicurezza Descrizione |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
