ChemNet > CAS > 643-28-7 2-Isopropylaniline
643-28-7 2-Isopropylaniline
| Nome del prodotto |
2-Isopropylaniline |
| Sinonimi |
2-Aminocumene; 2-(1-methylethyl)-benzenamine; 2-(propan-2-yl)aniline |
| Formula molecolare |
C9H13N |
| Peso Molecolare |
135.2062 |
| InChI |
InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
| Numero CAS |
643-28-7 |
| EINECS |
211-397-7 |
| Struttura molecolare |
|
| Densità |
0.953g/cm3 |
| Punto di ebollizione |
225.6°C at 760 mmHg |
| Indice di rifrazione |
1.542 |
| Punto d'infiammabilità |
95.6°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
