ChemNet > CAS > 6638-05-7 2,6-Dimethoxy-4-methylphenol
6638-05-7 2,6-Dimethoxy-4-methylphenol
| Nome del prodotto |
2,6-Dimethoxy-4-methylphenol |
| Sinonimi |
4-Methyl-2,6-dimethoxyphenol; 4-Hydroxy-3,5-dimethoxytoluene; 2,6-dimethoxy-4-methyl-phenol; 2,6-dimethoxy-p-cresol; 4-methylsyringol; 4-methylsyringol |
| Formula molecolare |
C9H12O3 |
| Peso Molecolare |
168.1898 |
| InChI |
InChI=1/C9H12O3/c1-6-4-7(11-2)9(10)8(5-6)12-3/h4-5,10H,1-3H3 |
| Numero CAS |
6638-05-7 |
| EINECS |
229-641-6 |
| Struttura molecolare |
|
| Densità |
1.105g/cm3 |
| Punto di fusione |
35-146℃ |
| Punto di ebollizione |
268.3°C at 760 mmHg |
| Indice di rifrazione |
1.52 |
| Punto d'infiammabilità |
116.1°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
