ChemNet > CAS > 6972-51-6 2,5-Dimethylphenethylalcohol
6972-51-6 2,5-Dimethylphenethylalcohol
| Nome del prodotto |
2,5-Dimethylphenethylalcohol |
| Sinonimi |
2,5-Dimethylphenethyl alcohol; 2-(2,5-dimethylphenyl)ethanol |
| Formula molecolare |
C10H14O |
| Peso Molecolare |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-8-3-4-9(2)10(7-8)5-6-11/h3-4,7,11H,5-6H2,1-2H3 |
| Numero CAS |
6972-51-6 |
| Struttura molecolare |
|
| Densità |
0.986g/cm3 |
| Punto di ebollizione |
267.6°C at 760 mmHg |
| Indice di rifrazione |
1.529 |
| Punto d'infiammabilità |
126°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
