ChemNet > CAS > 7512-17-6;134451-94-8 N-acetyl-D-(+)-glucosamine
7512-17-6;134451-94-8 N-acetyl-D-(+)-glucosamine
| Nome del prodotto |
N-acetyl-D-(+)-glucosamine |
| Sinonimi |
n-acetyl-beta-d-glucosamine; n-acetyl-d-glucosamine; 2-acetamido-2-deoxy-d-glucopyranose; N-((1R,2R,3S,4R)-1-FORMYL-2,3,4,5-TETRAHYDROXY-PENTYL)-ACETAMIDE; N-ACETYL-D-GLUCOSAMINE, IMMOBILIZED ON DIVINYLSULFONE-ACTIVATED AGAROSE 6B; N-ACETYL-D-GLUCOSAMINIDE; N-ACETYLGLUCOSAMINE; ACETYL-D-GLUCOSAMINE, N-; 2-ACETAMIDO-2-DEOXY-D-GLUCOSE; 2-(acetylamino)-2-deoxy-d-glucos; 2-ACETAMIDO-2-DESOXY-D-GLUCOPYRANOSE; 2-ACETAMIDO-2-DEOXY GLUCOPYRANOSE; D-GLCNAC; N-ACETYL-L-GLUCOSAMINE; N-[2,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-3-YL]ACETAMIDE; 2-(acetylamino)-2-deoxy-alpha-D-glucopyranose; 2-(acetylamino)-2-deoxyhexose; N-Acetyl-β-D-glucosamine |
| Formula molecolare |
C8H15NO6 |
| Peso Molecolare |
221.2078 |
| InChI |
InChI=1/C8H15NO6/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11/h2,5-8,11,13-15H,3H2,1H3,(H,9,12) |
| Numero CAS |
7512-17-6;134451-94-8 |
| EINECS |
231-368-2 |
| Struttura molecolare |
|
| Densità |
1.423g/cm3 |
| Punto di fusione |
201-204℃ |
| Punto di ebollizione |
636.4°C at 760 mmHg |
| Indice di rifrazione |
1.541 |
| Punto d'infiammabilità |
338.7°C |
| Solubilità in acqua |
H2O: 50 mg/mL colorless to faint yellow solution, clear to very slightly hazy |
| Simboli di pericolo |
 Xi:;
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:;
|
|
