ChemNet > CAS > 771-62-0 pentafluorothiophenol
771-62-0 pentafluorothiophenol
| Nome del prodotto |
pentafluorothiophenol |
| Sinonimi |
Pentafluorobenzenethiol |
| Formula molecolare |
C6HF5S |
| Peso Molecolare |
200.12 |
| InChI |
InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| Numero CAS |
771-62-0 |
| EINECS |
212-236-3 |
| Struttura molecolare |
|
| Densità |
1.5 |
| Punto di fusione |
-24℃ |
| Punto di ebollizione |
143℃ |
| Indice di rifrazione |
1.463-1.465 |
| Punto d'infiammabilità |
51℃ |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R10:Flammable.;
R34:Causes burns.;
|
| Sicurezza Descrizione |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
