ChemNet > CAS > 83463-62-1 Bromochloroacetonitrile
83463-62-1 Bromochloroacetonitrile
| Nome del prodotto |
Bromochloroacetonitrile |
| Sinonimi |
Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
| Formula molecolare |
C2HBrClN |
| Peso Molecolare |
154.393 |
| InChI |
InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
| Numero CAS |
83463-62-1 |
| Struttura molecolare |
|
| Densità |
1.932g/cm3 |
| Punto di ebollizione |
121.1°C at 760 mmHg |
| Indice di rifrazione |
1.506 |
| Punto d'infiammabilità |
27.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
