ChemNet > CAS > 88105-17-3 Methyl 3-chlorothiophene-2-carboxylate
88105-17-3 Methyl 3-chlorothiophene-2-carboxylate
| Nome del prodotto |
Methyl 3-chlorothiophene-2-carboxylate |
| Formula molecolare |
C6H5ClO2S |
| Peso Molecolare |
176.6207 |
| InChI |
InChI=1/C6H5ClO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,1H3 |
| Numero CAS |
88105-17-3 |
| Struttura molecolare |
|
| Densità |
1.371g/cm3 |
| Punto di fusione |
37-74℃ |
| Punto di ebollizione |
239°C at 760 mmHg |
| Indice di rifrazione |
1.554 |
| Punto d'infiammabilità |
98.3°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
