ChemNet > CAS > 91983-26-5 (4-Cyanomethylphenyl)boronic acid
91983-26-5 (4-Cyanomethylphenyl)boronic acid
| Nome del prodotto |
(4-Cyanomethylphenyl)boronic acid |
| Sinonimi |
4-(Cyanomethyl)benzeneboronic acid; 4-Boronophenylacetonitrile; 4-(Cyanomethyl)phenylboronic acid; [4-(cyanomethyl)phenyl]boronic acid |
| Formula molecolare |
C8H8BNO2 |
| Peso Molecolare |
160.9656 |
| InChI |
InChI=1/C8H8BNO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,11-12H,5H2 |
| Numero CAS |
91983-26-5 |
| Struttura molecolare |
|
| Densità |
1.2g/cm3 |
| Punto di ebollizione |
375.7°C at 760 mmHg |
| Indice di rifrazione |
1.548 |
| Punto d'infiammabilità |
181°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
