ChemNet > CAS > 92643-16-8 6-bromo-1-(chloromethyl)-2-methoxynaphthalene
92643-16-8 6-bromo-1-(chloromethyl)-2-methoxynaphthalene
| Nome del prodotto |
6-bromo-1-(chloromethyl)-2-methoxynaphthalene |
| Sinonimi |
w6-Bromo-1-(chloromethyl)-2-methoxynaphthalene |
| Formula molecolare |
C12H10BrClO |
| Peso Molecolare |
285.5642 |
| InChI |
InChI=1/C12H10BrClO/c1-15-12-5-2-8-6-9(13)3-4-10(8)11(12)7-14/h2-6H,7H2,1H3 |
| Numero CAS |
92643-16-8 |
| Struttura molecolare |
|
| Densità |
1.491g/cm3 |
| Punto di fusione |
144℃ |
| Punto di ebollizione |
379.5°C at 760 mmHg |
| Indice di rifrazione |
1.631 |
| Punto d'infiammabilità |
183.3°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
