ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
| 상품명칭 |
2-bromo-4-fluoroacetophenone |
| 별명 |
2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
| 분자식 |
C8H6BrFO |
| 분자량 |
217.035 |
| InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| cas번호 |
1006-39-9 |
| EC번호 |
222-263-2 |
| 분자 구조 |
|
| 밀도 |
1.535g/cm3 |
| 비등점 |
258.4°C at 760 mmHg |
| 굴절 지수 |
1.534 |
| 인화점 |
110.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
