ChemNet > CAS > 10074-13-2 2,4,6-trimethyl-1,3-benzenedimethanethiol
10074-13-2 2,4,6-trimethyl-1,3-benzenedimethanethiol
상품명칭 |
2,4,6-trimethyl-1,3-benzenedimethanethiol |
별명 |
2,4-Bis-(mercaptomethyl)-mesitylene; [3-(Mercaptomethyl)-2,4,6-trimethylphenyl]methanethiol; (2,4,6-trimethylbenzene-1,3-diyl)dimethanethiol |
분자식 |
C11H16S2 |
분자량 |
212.3747 |
InChI |
InChI=1/C11H16S2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4,12-13H,5-6H2,1-3H3 |
cas번호 |
10074-13-2 |
분자 구조 |
|
밀도 |
1.067g/cm3 |
녹는 점 |
67-68℃ |
비등점 |
342.9°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
142.3°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|