상품명칭 |
Phytol |
별명 |
phytol, mixture of isomers; (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol; (2E)-3,7,11,15-tetramethylhexadec-2-en-1-ol; (2E,7R,11S)-3,7,11,15-tetramethylhexadec-2-en-1-ol; Natural Phytol |
분자식 |
C20H40O |
분자량 |
296.531 |
InChI |
InChI=1/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19+/m0/s1 |
cas번호 |
150-86-7;102608-53-7 |
EC번호 |
205-776-6 |
분자 구조 |
|
밀도 |
0.845g/cm3 |
비등점 |
335.486°C at 760 mmHg |
굴절 지수 |
1.46 |
인화점 |
157.526°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|