ChemNet > CAS > 103-78-6 cyclohexylacetone
103-78-6 cyclohexylacetone
상품명칭 |
cyclohexylacetone |
별명 |
Cyclohexylacetone, (Acetonylcyclohexane); Acetonylcyclohexane; Cyclohexyacetone; 1-cyclohexylpropan-2-one; 1-cyclohexylacetone |
분자식 |
C9H16O |
분자량 |
140.2227 |
InChI |
InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
cas번호 |
103-78-6 |
EC번호 |
203-143-9 |
분자 구조 |
|
밀도 |
0.889g/cm3 |
비등점 |
188.1°C at 760 mmHg |
굴절 지수 |
1.441 |
인화점 |
65.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|