ChemNet > CAS > 10354-00-4 dibenzosuberenol
10354-00-4 dibenzosuberenol
상품명칭 |
dibenzosuberenol |
별명 |
dibenzo(b,f)cyclohepten-1-ol; 5H-Dibenzo[a,d]cyclohepten-5-ol; Dibenzo[b,f]cyclohepten-1-ol; 5H-dibenzo[a,d][7]annulen-5-ol |
분자식 |
C15H12O |
분자량 |
208.2552 |
InChI |
InChI=1/C15H12O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10,15-16H |
cas번호 |
10354-00-4 |
EC번호 |
233-774-5 |
분자 구조 |
|
밀도 |
1.196g/cm3 |
녹는 점 |
122.5-124℃ |
비등점 |
401.9°C at 760 mmHg |
굴절 지수 |
1.659 |
인화점 |
147.6°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|