ChemNet > CAS > 103956-09-8 3,4-Diaminobenzhydrazide
103956-09-8 3,4-Diaminobenzhydrazide
상품명칭 |
3,4-Diaminobenzhydrazide |
별명 |
3,4-diaminobenzohydrazide |
분자식 |
C7H10N4O |
분자량 |
166.1805 |
InChI |
InChI=1/C7H10N4O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,8-10H2,(H,11,12) |
cas번호 |
103956-09-8 |
분자 구조 |
|
밀도 |
1.367g/cm3 |
굴절 지수 |
1.705 |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|