ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
상품명칭 |
3-Hydroxyphenylacetylene |
별명 |
3-Ethynylphenol |
분자식 |
C8H6O |
분자량 |
118.1326 |
InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
cas번호 |
10401-11-3 |
분자 구조 |
|
밀도 |
1.12g/cm3 |
비등점 |
230.9°C at 760 mmHg |
굴절 지수 |
1.589 |
인화점 |
106.1°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|