ChemNet > CAS > 104163-35-1 3-Methylthiophene-2-methylamine
104163-35-1 3-Methylthiophene-2-methylamine
| 상품명칭 |
3-Methylthiophene-2-methylamine |
| 별명 |
2-Aminomethyl-3-methylthiophene; (3-Methyl-2-thienyl)methylamine; 1-(3-methylthiophen-2-yl)methanamine |
| 분자식 |
C6H9NS |
| 분자량 |
127.2074 |
| InChI |
InChI=1/C6H9NS/c1-5-2-3-8-6(5)4-7/h2-3H,4,7H2,1H3 |
| cas번호 |
104163-35-1 |
| 분자 구조 |
|
| 밀도 |
1.104g/cm3 |
| 비등점 |
204.6°C at 760 mmHg |
| 굴절 지수 |
1.572 |
| 인화점 |
77.5°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
