ChemNet > CAS > 105-08-8 1,4-Cyclohexanedimethanol, mixture of cisand trans
105-08-8 1,4-Cyclohexanedimethanol, mixture of cisand trans
| 상품명칭 |
1,4-Cyclohexanedimethanol, mixture of cisand trans |
| 별명 |
1,4-Bis(hydroxymethyl)cyclohexane; cyclohex-1,4-ylenedimethanol; 1,4-Cyclohexane dimethanol; cyclohexane-1,4-diyldimethanol; 1,4-Cyclohexanedimethanol; CHDM |
| 분자식 |
C8H16O2 |
| 분자량 |
144.2114 |
| InChI |
InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
| cas번호 |
105-08-8 |
| EC번호 |
203-268-9 |
| 분자 구조 |
|
| 밀도 |
1.004g/cm3 |
| 녹는 점 |
31.5℃ |
| 비등점 |
286.2°C at 760 mmHg |
| 굴절 지수 |
1.47 |
| 인화점 |
161.1°C |
| 물 용해도 |
miscible |
| 위험성 표시 |
|
| 리스크 규칙 |
R36:;
|
| 보안 규칙 |
S26:;
S39:;
|
|
- Gold Suppliers(16):
- 1Jiangsu Qingquan Chemical Co., Ltd.
- 2Ningbo jiasi chemical Co.,ltd.
- 3Zhejiang Sunfit Advanced Materials Co., Ltd.
- 4BSM Chemical Co.,Ltd.
- 5JiangSu Hengxiang Chemical Co.,LTD.
- 6Ningbo Sun Yu Chemical Import&Export Co.,Ltd.
- 7Shanghai Domen International Co., Ltd
- 8Shaoxing Shangyu gongli Chemical Co.,Ltd.
- 9Shanghai Zabchem Co.,Ltd.
- 10Ningbo Jiasi Chemical Co.,Ltd.
