ChemNet > CAS > 1070-62-8 Ethyl hydrogen glutarate
1070-62-8 Ethyl hydrogen glutarate
상품명칭 |
Ethyl hydrogen glutarate |
별명 |
Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate |
분자식 |
C7H12O4 |
분자량 |
160.1678 |
InChI |
InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
cas번호 |
1070-62-8 |
EC번호 |
213-977-5 |
분자 구조 |
|
밀도 |
1.126g/cm3 |
비등점 |
280°C at 760 mmHg |
굴절 지수 |
1.444 |
인화점 |
112.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|