ChemNet > CAS > 1073-29-6 2-Hydroxythioanisole
1073-29-6 2-Hydroxythioanisole
| 상품명칭 |
2-Hydroxythioanisole |
| 별명 |
2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
| 분자식 |
C7H8OS |
| 분자량 |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| cas번호 |
1073-29-6 |
| EC번호 |
214-027-2 |
| 분자 구조 |
|
| 밀도 |
1.19g/cm3 |
| 비등점 |
206.1°C at 760 mmHg |
| 굴절 지수 |
1.613 |
| 인화점 |
108°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
