ChemNet > CAS > 1121-24-0 2-Hydroxythiophenol
1121-24-0 2-Hydroxythiophenol
| 상품명칭 |
2-Hydroxythiophenol |
| 별명 |
2-Hydroxythiophenol, (2-Mercaptophenol); 2-Mercaptophenol; 2-sulfanylphenol |
| 분자식 |
C6H6OS |
| 분자량 |
126.1762 |
| InChI |
InChI=1/C6H6OS/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| cas번호 |
1121-24-0 |
| EC번호 |
214-326-8 |
| 분자 구조 |
|
| 밀도 |
1.255g/cm3 |
| 비등점 |
223.7°C at 760 mmHg |
| 굴절 지수 |
1.642 |
| 인화점 |
89.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
