ChemNet > CAS > 1122-60-7 nitrocyclohexane
1122-60-7 nitrocyclohexane
| 상품명칭 |
nitrocyclohexane |
| 별명 |
Hexahydronitrobenzene |
| 분자식 |
C6H11NO2 |
| 분자량 |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| cas번호 |
1122-60-7 |
| EC번호 |
214-354-0 |
| 분자 구조 |
|
| 밀도 |
1.05g/cm3 |
| 비등점 |
202.8°C at 760 mmHg |
| 굴절 지수 |
1.465 |
| 인화점 |
81.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
