ChemNet > CAS > 1138-60-9 isopropyl 3,4,5-trihydroxybenzoate
1138-60-9 isopropyl 3,4,5-trihydroxybenzoate
상품명칭 |
isopropyl 3,4,5-trihydroxybenzoate |
별명 |
Isopropyl gallate; Gallic acid isopropyl ester; propan-2-yl 3,4,5-trihydroxybenzoate; Isopropylgallate |
분자식 |
C10H12O5 |
분자량 |
212.1993 |
InChI |
InChI=1/C10H12O5/c1-5(2)15-10(14)6-3-7(11)9(13)8(12)4-6/h3-5,11-13H,1-2H3 |
cas번호 |
1138-60-9 |
EC번호 |
214-515-5 |
분자 구조 |
|
밀도 |
1.36g/cm3 |
비등점 |
439.5°C at 760 mmHg |
굴절 지수 |
1.593 |
인화점 |
177.4°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|