ChemNet > CAS > 117-18-0 2,3,5,6-Tetrachloronitrobenzene
117-18-0 2,3,5,6-Tetrachloronitrobenzene
| 상품명칭 |
2,3,5,6-Tetrachloronitrobenzene |
| 별명 |
1,2,4,5-Tetrachloro-3-nitrobenzene; tecnazene; 3-Nitro-1,2,4,5-tetrachlorobenzene; Tecnazene; 1,2,3,4,5-pentachloro-6-nitrobenzene; 1,2,3,4-Tetrachloro-3-Nitrobenzene; Fumite(R); Fusarex(R); LABOTEST-BB LT00152717 |
| 분자식 |
C6HCl4NO2 |
| 분자량 |
260.8896 |
| InChI |
InChI=1/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| cas번호 |
117-18-0 |
| EC번호 |
204-178-2 |
| 분자 구조 |
|
| 밀도 |
1.75g/cm3 |
| 녹는 점 |
98-101℃ |
| 비등점 |
304°C at 760 mmHg |
| 굴절 지수 |
1.62 |
| 인화점 |
143.1°C |
| 위험성 표시 |
 Xn:Harmful;
 N:Dangerous for the environment;
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R43:May cause sensitization by skin contact.;
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| 보안 규칙 |
S24:Avoid contact with skin.;
S37:Wear suitable gloves.;
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
