ChemNet > CAS > 119221-62-4 5-(2,6-dichloro-4-pyridyl)-1,3,4-oxadiazole-2-thiol
119221-62-4 5-(2,6-dichloro-4-pyridyl)-1,3,4-oxadiazole-2-thiol
상품명칭 |
5-(2,6-dichloro-4-pyridyl)-1,3,4-oxadiazole-2-thiol |
별명 |
5-(2,6-dichloropyridin-4-yl)-1,3,4-oxadiazole-2(3H)-thione |
분자식 |
C7H3Cl2N3OS |
분자량 |
248.0892 |
InChI |
InChI=1/C7H3Cl2N3OS/c8-4-1-3(2-5(9)10-4)6-11-12-7(14)13-6/h1-2H,(H,12,14) |
cas번호 |
119221-62-4 |
분자 구조 |
|
밀도 |
1.82g/cm3 |
녹는 점 |
205℃ |
비등점 |
358.9°C at 760 mmHg |
굴절 지수 |
1.773 |
인화점 |
170.9°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|