ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
상품명칭 |
4-(Dimethylamino)benzonitrile |
별명 |
4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
분자식 |
C9H10N2 |
분자량 |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
cas번호 |
1197-19-9 |
EC번호 |
214-819-8 |
분자 구조 |
|
밀도 |
1.04g/cm3 |
녹는 점 |
70-76℃ |
비등점 |
318.8°C at 760 mmHg |
굴절 지수 |
1.55 |
인화점 |
145.4°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|