ChemNet > CAS > 1198-37-4 2,4-dimethylquinoline
1198-37-4 2,4-dimethylquinoline
상품명칭 |
2,4-dimethylquinoline |
별명 |
Dimethylquinoline |
분자식 |
C11H11N |
분자량 |
157.2117 |
InChI |
InChI=1/C11H11N/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
cas번호 |
1198-37-4 |
EC번호 |
214-832-9 |
분자 구조 |
|
밀도 |
1.052g/cm3 |
비등점 |
263.8°C at 760 mmHg |
굴절 지수 |
1.61 |
인화점 |
107.6°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|