ChemNet > CAS > 120-22-9 N,N-Diethyl-4-nitrosoaniline
120-22-9 N,N-Diethyl-4-nitrosoaniline
| 상품명칭 |
N,N-Diethyl-4-nitrosoaniline |
| 별명 |
4-Nitroso-N,N-diethylaniline |
| 분자식 |
C10H14N2O |
| 분자량 |
178.231 |
| InChI |
InChI=1/C10H14N2O/c1-3-12(4-2)10-7-5-9(11-13)6-8-10/h5-8H,3-4H2,1-2H3 |
| cas번호 |
120-22-9 |
| EC번호 |
204-379-5 |
| 분자 구조 |
|
| 밀도 |
1.01g/cm3 |
| 녹는 점 |
81-85℃ |
| 비등점 |
290.3°C at 760 mmHg |
| 굴절 지수 |
1.52 |
| 인화점 |
129.4°C |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| 보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S37:Wear suitable gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
