ChemNet > CAS > 120-44-5 Desoxyanisoin
120-44-5 Desoxyanisoin
상품명칭 |
Desoxyanisoin |
별명 |
4-Methoxy-2-(4-methoxyphenyl)acetophenone; Desoxyanisoin~4-Methoxybenzyl 4-methoxyphenyl ketone; 4,4-dimethoxydeoxybenzoin; 4-methoxybenzyl 4-methoxyphenyl ketone; Deoxyanisoin; 1,2-bis(4-methoxyphenyl)ethanone |
분자식 |
C16H16O3 |
분자량 |
256.2964 |
InChI |
InChI=1/C16H16O3/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10H,11H2,1-2H3 |
cas번호 |
120-44-5 |
EC번호 |
204-396-8 |
분자 구조 |
|
밀도 |
1.115g/cm3 |
녹는 점 |
109-112℃ |
비등점 |
415.6°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
196.9°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|