ChemNet > CAS > 1210-34-0 Dibenzosuberol
1210-34-0 Dibenzosuberol
| 상품명칭 |
Dibenzosuberol |
| 별명 |
10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ol; dibenzo(b,f)cycloheptan-1-ol; Dibenzo[b,f]-1-cycloheptanol; 10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ol; 10,11-Dihydro-5H-dibenzo[a,d]cyclohetpten-5-ol |
| 분자식 |
C15H14O |
| 분자량 |
210.2711 |
| InChI |
InChI=1/C15H14O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2 |
| cas번호 |
1210-34-0 |
| EC번호 |
214-911-8 |
| 분자 구조 |
|
| 밀도 |
1.163g/cm3 |
| 녹는 점 |
90-95℃ |
| 비등점 |
365.5°C at 760 mmHg |
| 굴절 지수 |
1.633 |
| 인화점 |
135.6°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
