ChemNet > CAS > 130560-97-3 3-chloro-4-fluorothiobenzamide
130560-97-3 3-chloro-4-fluorothiobenzamide
상품명칭 |
3-chloro-4-fluorothiobenzamide |
별명 |
3-Chloro-4-fluorobenzene-1-carbothioamide; 3-chloro-4-fluorobenzenecarbothioamide |
분자식 |
C7H5ClFNS |
분자량 |
189.6377 |
InChI |
InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
cas번호 |
130560-97-3 |
분자 구조 |
|
밀도 |
1.434g/cm3 |
녹는 점 |
129-130℃ |
비등점 |
285.5°C at 760 mmHg |
굴절 지수 |
1.635 |
인화점 |
126.5°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|