ChemNet > CAS > 13185-00-7 6,6'-Dibromo-1,1'-bi-2-naphthol
13185-00-7 6,6'-Dibromo-1,1'-bi-2-naphthol
상품명칭 |
6,6'-Dibromo-1,1'-bi-2-naphthol |
별명 |
Dibromobinaphtol; racemic-6,6-Dibromo-1,1-bi-2-naphtol,99%; 6,6'-dibromo-1,1'-binaphthalene-2,2'-diol |
분자식 |
C20H12Br2O2 |
분자량 |
444.1161 |
InChI |
InChI=1/C20H12Br2O2/c21-13-3-5-15-11(9-13)1-7-17(23)19(15)20-16-6-4-14(22)10-12(16)2-8-18(20)24/h1-10,23-24H |
cas번호 |
13185-00-7 |
분자 구조 |
|
밀도 |
1.761g/cm3 |
녹는 점 |
202-205℃ |
비등점 |
546.2°C at 760 mmHg |
굴절 지수 |
1.778 |
인화점 |
284.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|