ChemNet > CAS > 13195-79-4 alpha,alpha,4-Tribromoacetophenone
13195-79-4 alpha,alpha,4-Tribromoacetophenone
| 상품명칭 |
alpha,alpha,4-Tribromoacetophenone |
| 별명 |
Acetophenone, 2,2,4'-tribromo-; 2,2,4'-Tribromoacetophenone; 2,2-Dibromo-1-(4-bromophenyl)ethanone; 3-07-00-00987 (Beilstein Handbook Reference); 4,alpha,alpha-Tribromoacetophenone; 4alpha,alpha-Tribromoacetophenone; BRN 1949157; NSC 78440; 2,2-Dibromo-1-(4-bromophenyl)ethan-1-one; Ethanone, 2,2-dibromo-1-(4-bromophenyl)- (9CI); 3-amino-2-methylquinazolin-4(3H)-one |
| 분자식 |
C9H9N3O |
| 분자량 |
175.1873 |
| InChI |
InChI=1/C9H9N3O/c1-6-11-8-5-3-2-4-7(8)9(13)12(6)10/h2-5H,10H2,1H3 |
| cas번호 |
13195-79-4 |
| EC번호 |
236-161-0 |
| 분자 구조 |
|
| 밀도 |
1.35g/cm3 |
| 비등점 |
348.1°C at 760 mmHg |
| 굴절 지수 |
1.675 |
| 인화점 |
164.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
