상품명칭 |
1,6-Anhydro-beta-D-glucose-2,3,4-tri-O-acetate |
별명 |
1,6-anhydro-B-D-glucose 2,3,4-*triacetate; 1,6-Anhydro-2,3,4-tri-O-acetyl--D-glucopyranose; 6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name); (1S,2R,3S,4R,5S)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name); (1R,2R,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name) |
분자식 |
C12H16O8 |
분자량 |
288.2506 |
InChI |
InChI=1/C12H16O8/c1-5(13)17-9-8-4-16-12(20-8)11(19-7(3)15)10(9)18-6(2)14/h8-12H,4H2,1-3H3/t8-,9-,10+,11-,12-/m1/s1 |
cas번호 |
13242-55-2 |
EC번호 |
236-222-1 |
분자 구조 |
|
밀도 |
1.344g/cm3 |
녹는 점 |
111℃ |
비등점 |
392°C at 760 mmHg |
굴절 지수 |
1.494 |
인화점 |
147.326°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|