ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
상품명칭 |
Difluoromandelicacid |
별명 |
3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
분자식 |
C8H6F2O3 |
분자량 |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
cas번호 |
132741-29-8 |
분자 구조 |
|
밀도 |
1.522g/cm3 |
녹는 점 |
92-94℃ |
비등점 |
320.7°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
147.8°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|