ChemNet > CAS > 132980-99-5 3,5-difluorobenzamide
132980-99-5 3,5-difluorobenzamide
| 상품명칭 |
3,5-difluorobenzamide |
| 별명 |
Difluorobenzamide6 |
| 분자식 |
C7H5F2NO |
| 분자량 |
157.1175 |
| InChI |
InChI=1/C7H5F2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| cas번호 |
132980-99-5 |
| 분자 구조 |
|
| 밀도 |
1.348g/cm3 |
| 녹는 점 |
155-157℃ |
| 비등점 |
187.7°C at 760 mmHg |
| 굴절 지수 |
1.515 |
| 인화점 |
67.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
