ChemNet > CAS > 13327-27-0 6-Methylpyridazin-3(2H)-one
13327-27-0 6-Methylpyridazin-3(2H)-one
| 상품명칭 |
6-Methylpyridazin-3(2H)-one |
| 별명 |
6-Methyl-3(2H)-pyridazinone; 6-Methylpyridazin-3-one;
; 6-methylpyridazin-3-ol; 6-Methyl-2H-pyridazin-3-one |
| 분자식 |
C5H6N2O |
| 분자량 |
110.1139 |
| InChI |
InChI=1/C5H6N2O/c1-4-2-3-5(8)7-6-4/h2-3H,1H3,(H,7,8) |
| cas번호 |
13327-27-0 |
| EC번호 |
236-367-0 |
| 분자 구조 |
|
| 밀도 |
1.22g/cm3 |
| 비등점 |
310.3°C at 760 mmHg |
| 굴절 지수 |
1.576 |
| 인화점 |
141.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
