ChemNet > CAS > 13589-72-5 5-chloro-2-hydroxybenzonitrile
13589-72-5 5-chloro-2-hydroxybenzonitrile
| 상품명칭 |
5-chloro-2-hydroxybenzonitrile |
| 분자식 |
C7H4ClNO |
| 분자량 |
153.5658 |
| InChI |
InChI=1/C7H4ClNO/c8-6-1-2-7(10)5(3-6)4-9/h1-3,10H |
| cas번호 |
13589-72-5 |
| 분자 구조 |
|
| 밀도 |
1.41g/cm3 |
| 녹는 점 |
152℃ |
| 비등점 |
269.4°C at 760 mmHg |
| 굴절 지수 |
1.611 |
| 인화점 |
116.7°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
