ChemNet > CAS > 13679-73-7 2-Acetyl-4-methylthiophene
13679-73-7 2-Acetyl-4-methylthiophene
| 상품명칭 |
2-Acetyl-4-methylthiophene |
| 별명 |
1-(4-Methyl-2-thienyl)ethan-1-one; AI3-61742; Ethanone, 1-(4-methyl-2-thienyl)-; 1-(4-methylthiophen-2-yl)ethanone |
| 분자식 |
C7H8OS |
| 분자량 |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-7(6(2)8)9-4-5/h3-4H,1-2H3 |
| cas번호 |
13679-73-7 |
| EC번호 |
237-180-7 |
| 분자 구조 |
|
| 밀도 |
1.106g/cm3 |
| 비등점 |
236.9°C at 760 mmHg |
| 굴절 지수 |
1.535 |
| 인화점 |
97.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
