ChemNet > CAS > 13888-77-2 (pentafluorophenyl)dimethylsilane
13888-77-2 (pentafluorophenyl)dimethylsilane
상품명칭 |
(pentafluorophenyl)dimethylsilane |
별명 |
Dimethyl(pentafluorophenyl)silane |
분자식 |
C8H7F5Si |
분자량 |
226.2187 |
InChI |
InChI=1/C8H7F5Si/c1-14(2)8-6(12)4(10)3(9)5(11)7(8)13/h14H,1-2H3 |
cas번호 |
13888-77-2 |
분자 구조 |
|
비등점 |
163.8°C at 760 mmHg |
인화점 |
40.6°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|