ChemNet > CAS > 14109-72-9 1-Methylthio-2-propanone
14109-72-9 1-Methylthio-2-propanone
상품명칭 |
1-Methylthio-2-propanone |
별명 |
1-(Methylsulfanyl)acetone; 1-(methylthio)acetone; 1-METHYLTHIO-2-PROPANONE; 2-propanone, 1-(methylthio)-; 1-(methylsulfanyl)propan-2-one; 1-Methylthio propanone |
분자식 |
C4H8OS |
분자량 |
104.1707 |
InChI |
InChI=1/C4H8OS/c1-4(5)3-6-2/h3H2,1-2H3 |
cas번호 |
14109-72-9 |
분자 구조 |
|
밀도 |
0.985g/cm3 |
비등점 |
144°C at 760 mmHg |
굴절 지수 |
1.453 |
인화점 |
42.8°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|