ChemNet > CAS > 141134-24-9 4-(difluoromethoxy)phenacyl bromide
141134-24-9 4-(difluoromethoxy)phenacyl bromide
상품명칭 |
4-(difluoromethoxy)phenacyl bromide |
별명 |
2-Bromo-1-[4-(difluoromethoxy)phenyl]ethan-1-one; 2-bromo-1-[4-(difluoromethoxy)phenyl]ethanone |
분자식 |
C9H7BrF2O2 |
분자량 |
265.0515 |
InChI |
InChI=1/C9H7BrF2O2/c10-5-8(13)6-1-3-7(4-2-6)14-9(11)12/h1-4,9H,5H2 |
cas번호 |
141134-24-9 |
분자 구조 |
|
밀도 |
1.564g/cm3 |
녹는 점 |
66-68℃ |
비등점 |
301.9°C at 760 mmHg |
굴절 지수 |
1.513 |
인화점 |
136.4°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|