ChemNet > CAS > 14199-83-8 1-Deoxy-1-nitro-D-mannitol
14199-83-8 1-Deoxy-1-nitro-D-mannitol
상품명칭 |
1-Deoxy-1-nitro-D-mannitol |
별명 |
AI3-62628; D-Mannitol, 1-deoxy-1-nitro-; 1-deoxy-1-nitrohexitol |
분자식 |
C6H13NO7 |
분자량 |
211.1699 |
InChI |
InChI=1/C6H13NO7/c8-2-4(10)6(12)5(11)3(9)1-7(13)14/h3-6,8-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
cas번호 |
14199-83-8 |
EC번호 |
238-051-8 |
분자 구조 |
|
밀도 |
1.632g/cm3 |
녹는 점 |
133℃ |
비등점 |
608.3°C at 760 mmHg |
굴절 지수 |
1.585 |
인화점 |
269°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|