ChemNet > CAS > 1436-43-7 2-quinolinecarbonitrile
1436-43-7 2-quinolinecarbonitrile
| 상품명칭 |
2-quinolinecarbonitrile |
| 별명 |
Quinoline-2-carbonitrile; 2-Cyanoquinoline |
| 분자식 |
C10H6N2 |
| 분자량 |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H |
| cas번호 |
1436-43-7 |
| EC번호 |
215-865-1 |
| 분자 구조 |
|
| 밀도 |
1.21g/cm3 |
| 녹는 점 |
93-95℃ |
| 비등점 |
323.7°C at 760 mmHg |
| 굴절 지수 |
1.654 |
| 인화점 |
115.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
